C24H24Cl2O12S3 — CID 23538675
[4-[4-[4-(dichloromethoxy)-3-methylsulfonyloxyphenyl]-2,5-dimethoxy-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate (PubChem CID 23538675) has the molecular formula C24H24Cl2O12S3 and a molecular weight of 671.55 g/mol. Its IUPAC name is [4-[4-[4-(dichloromethoxy)-3-methylsulfonyloxyphenyl]-2,5-dimethoxy-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate.
| Compound Name | [4-[4-[4-(dichloromethoxy)-3-methylsulfonyloxyphenyl]-2,5-dimethoxy-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 23538675 |
| Molecular Formula | C24H24Cl2O12S3 |
| Molecular Weight | 671.55 g/mol |
| Exact Mass | 669.98 |
| IUPAC Name | [4-[4-[4-(dichloromethoxy)-3-methylsulfonyloxyphenyl]-2,5-dimethoxy-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate |
| SMILES | COc1cc(-c2ccc(OS(C)(=O)=O)cc2)c(OC)c(OS(C)(=O)=O)c1-c1ccc(OC(Cl)Cl)c(OS(C)(=O)=O)c1 |
| InChI | InChI=1S/C24H24Cl2O12S3/c1-33-20-13-17(14-6-9-16(10-7-14)36-39(3,27)28)22(34-2)23(38-41(5,31)32)21(20)15-8-11-18(35-24(25)26)19(12-15)37-40(4,29)30/h6-13,24H,1-5H3 |
| InChIKey | IWKNSAURDLOFAV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|