C30H36O10S2 — CID 89362103
[4-[4-(4-butoxy-3-methoxyphenyl)-2-(cyclopropylmethoxy)-5-methoxy-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate (PubChem CID 89362103) has the molecular formula C30H36O10S2 and a molecular weight of 620.74 g/mol. Its IUPAC name is [4-[4-(4-butoxy-3-methoxyphenyl)-2-(cyclopropylmethoxy)-5-methoxy-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate.
| Compound Name | [4-[4-(4-butoxy-3-methoxyphenyl)-2-(cyclopropylmethoxy)-5-methoxy-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 89362103 |
| Molecular Formula | C30H36O10S2 |
| Molecular Weight | 620.74 g/mol |
| Exact Mass | 620.17 |
| IUPAC Name | [4-[4-(4-butoxy-3-methoxyphenyl)-2-(cyclopropylmethoxy)-5-methoxy-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate |
| SMILES | CCCCOc1ccc(-c2c(OC)cc(-c3ccc(OS(C)(=O)=O)cc3)c(OCC3CC3)c2OS(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C30H36O10S2/c1-6-7-16-37-25-15-12-22(17-26(25)35-2)28-27(36-3)18-24(21-10-13-23(14-11-21)39-41(4,31)32)29(38-19-20-8-9-20)30(28)40-42(5,33)34/h10-15,17-18,20H,6-9,16,19H2,1-5H3 |
| InChIKey | OLAYDSKWUXGEND-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.74 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|