C28H32O10S2 — CID 23538701
[4-[3-(hydroxymethyl)-2,5-dimethoxy-4-[4-(3-methylbut-2-enoxy)-3-methylsulfonyloxyphenyl]phenyl]phenyl] methanesulfonate (PubChem CID 23538701) has the molecular formula C28H32O10S2 and a molecular weight of 592.69 g/mol. Its IUPAC name is [4-[3-(hydroxymethyl)-2,5-dimethoxy-4-[4-(3-methylbut-2-enoxy)-3-methylsulfonyloxyphenyl]phenyl]phenyl] methanesulfonate.
| Compound Name | [4-[3-(hydroxymethyl)-2,5-dimethoxy-4-[4-(3-methylbut-2-enoxy)-3-methylsulfonyloxyphenyl]phenyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 23538701 |
| Molecular Formula | C28H32O10S2 |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | [4-[3-(hydroxymethyl)-2,5-dimethoxy-4-[4-(3-methylbut-2-enoxy)-3-methylsulfonyloxyphenyl]phenyl]phenyl] methanesulfonate |
| SMILES | COc1cc(-c2ccc(OS(C)(=O)=O)cc2)c(OC)c(CO)c1-c1ccc(OCC=C(C)C)c(OS(C)(=O)=O)c1 |
| InChI | InChI=1S/C28H32O10S2/c1-18(2)13-14-36-24-12-9-20(15-25(24)38-40(6,32)33)27-23(17-29)28(35-4)22(16-26(27)34-3)19-7-10-21(11-8-19)37-39(5,30)31/h7-13,15-16,29H,14,17H2,1-6H3 |
| InChIKey | DDDGHNWUNGGWFI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|