C27H27NO6S — CID 23538285
[5-[4-(4-isocyanophenyl)-2,5-dimethoxyphenyl]-2-(3-methylbut-2-enoxy)phenyl] methanesulfonate (PubChem CID 23538285) has the molecular formula C27H27NO6S and a molecular weight of 493.58 g/mol. Its IUPAC name is [5-[4-(4-isocyanophenyl)-2,5-dimethoxyphenyl]-2-(3-methylbut-2-enoxy)phenyl] methanesulfonate.
| Compound Name | [5-[4-(4-isocyanophenyl)-2,5-dimethoxyphenyl]-2-(3-methylbut-2-enoxy)phenyl] methanesulfonate |
|---|---|
| PubChem CID | 23538285 |
| Molecular Formula | C27H27NO6S |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | [5-[4-(4-isocyanophenyl)-2,5-dimethoxyphenyl]-2-(3-methylbut-2-enoxy)phenyl] methanesulfonate |
| SMILES | [C-]#[N+]c1ccc(-c2cc(OC)c(-c3ccc(OCC=C(C)C)c(OS(C)(=O)=O)c3)cc2OC)cc1 |
| InChI | InChI=1S/C27H27NO6S/c1-18(2)13-14-33-24-12-9-20(15-27(24)34-35(6,29)30)23-17-25(31-4)22(16-26(23)32-5)19-7-10-21(28-3)11-8-19/h7-13,15-17H,14H2,1-2,4-6H3 |
| InChIKey | UIJIXVJLZLUMDA-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 75.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|