C27H27NO6S — CID 89362140
[5-[4-(4-cyanophenyl)-2,5-dimethoxyphenyl]-2-(3-methylbut-2-enoxy)phenyl] methanesulfonate (PubChem CID 89362140) has the molecular formula C27H27NO6S and a molecular weight of 493.58 g/mol. Its IUPAC name is [5-[4-(4-cyanophenyl)-2,5-dimethoxyphenyl]-2-(3-methylbut-2-enoxy)phenyl] methanesulfonate.
| Compound Name | [5-[4-(4-cyanophenyl)-2,5-dimethoxyphenyl]-2-(3-methylbut-2-enoxy)phenyl] methanesulfonate |
|---|---|
| PubChem CID | 89362140 |
| Molecular Formula | C27H27NO6S |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | [5-[4-(4-cyanophenyl)-2,5-dimethoxyphenyl]-2-(3-methylbut-2-enoxy)phenyl] methanesulfonate |
| SMILES | COc1cc(-c2ccc(OCC=C(C)C)c(OS(C)(=O)=O)c2)c(OC)cc1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C27H27NO6S/c1-18(2)12-13-33-24-11-10-21(14-27(24)34-35(5,29)30)23-16-25(31-3)22(15-26(23)32-4)20-8-6-19(17-28)7-9-20/h6-12,14-16H,13H2,1-5H3 |
| InChIKey | FNBQPOKLBDGMSA-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|