C29H34O8S — CID 21049212
[2-[3-ethoxy-4-(3-methylbut-2-enoxy)phenyl]-3,6-dimethoxy-5-(4-methoxyphenyl)phenyl] methanesulfonate (PubChem CID 21049212) has the molecular formula C29H34O8S and a molecular weight of 542.65 g/mol. Its IUPAC name is [2-[3-ethoxy-4-(3-methylbut-2-enoxy)phenyl]-3,6-dimethoxy-5-(4-methoxyphenyl)phenyl] methanesulfonate.
| Compound Name | [2-[3-ethoxy-4-(3-methylbut-2-enoxy)phenyl]-3,6-dimethoxy-5-(4-methoxyphenyl)phenyl] methanesulfonate |
|---|---|
| PubChem CID | 21049212 |
| Molecular Formula | C29H34O8S |
| Molecular Weight | 542.65 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | [2-[3-ethoxy-4-(3-methylbut-2-enoxy)phenyl]-3,6-dimethoxy-5-(4-methoxyphenyl)phenyl] methanesulfonate |
| SMILES | CCOc1cc(-c2c(OC)cc(-c3ccc(OC)cc3)c(OC)c2OS(C)(=O)=O)ccc1OCC=C(C)C |
| InChI | InChI=1S/C29H34O8S/c1-8-35-25-17-21(11-14-24(25)36-16-15-19(2)3)27-26(33-5)18-23(20-9-12-22(32-4)13-10-20)28(34-6)29(27)37-38(7,30)31/h9-15,17-18H,8,16H2,1-7H3 |
| InChIKey | XLIITQYKNSEULB-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.65 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|