C27H28O10S2 — CID 21049236
[4-[4-(4-but-3-ynoxy-3-methoxyphenyl)-2,5-dimethoxy-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate (PubChem CID 21049236) has the molecular formula C27H28O10S2 and a molecular weight of 576.65 g/mol. Its IUPAC name is [4-[4-(4-but-3-ynoxy-3-methoxyphenyl)-2,5-dimethoxy-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate.
| Compound Name | [4-[4-(4-but-3-ynoxy-3-methoxyphenyl)-2,5-dimethoxy-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 21049236 |
| Molecular Formula | C27H28O10S2 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.11 |
| IUPAC Name | [4-[4-(4-but-3-ynoxy-3-methoxyphenyl)-2,5-dimethoxy-3-methylsulfonyloxyphenyl]phenyl] methanesulfonate |
| SMILES | C#CCCOc1ccc(-c2c(OC)cc(-c3ccc(OS(C)(=O)=O)cc3)c(OC)c2OS(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C27H28O10S2/c1-7-8-15-35-22-14-11-19(16-23(22)32-2)25-24(33-3)17-21(26(34-4)27(25)37-39(6,30)31)18-9-12-20(13-10-18)36-38(5,28)29/h1,9-14,16-17H,8,15H2,2-6H3 |
| InChIKey | KJJSUOKQKNZLEB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|