C26H27FN2O4 — CID 23538942
[4-[4-[3-fluoro-4-(3-methylbut-2-enoxy)phenyl]-2,5-dimethoxyphenyl]phenyl]urea (PubChem CID 23538942) has the molecular formula C26H27FN2O4 and a molecular weight of 450.51 g/mol. Its IUPAC name is [4-[4-[3-fluoro-4-(3-methylbut-2-enoxy)phenyl]-2,5-dimethoxyphenyl]phenyl]urea.
| Compound Name | [4-[4-[3-fluoro-4-(3-methylbut-2-enoxy)phenyl]-2,5-dimethoxyphenyl]phenyl]urea |
|---|---|
| PubChem CID | 23538942 |
| Molecular Formula | C26H27FN2O4 |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | [4-[4-[3-fluoro-4-(3-methylbut-2-enoxy)phenyl]-2,5-dimethoxyphenyl]phenyl]urea |
| SMILES | COc1cc(-c2ccc(OCC=C(C)C)c(F)c2)c(OC)cc1-c1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C26H27FN2O4/c1-16(2)11-12-33-23-10-7-18(13-22(23)27)21-15-24(31-3)20(14-25(21)32-4)17-5-8-19(9-6-17)29-26(28)30/h5-11,13-15H,12H2,1-4H3,(H3,28,29,30) |
| InChIKey | ONEZTJSGIASCAB-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|