C24H23ClO6 — CID 58666110
2-[4-[(Z)-4-chlorobut-2-enoxy]-3-hydroxyphenyl]-5-(4-hydroxyphenyl)-3,6-dimethoxyphenol (PubChem CID 58666110) has the molecular formula C24H23ClO6 and a molecular weight of 442.90 g/mol. Its IUPAC name is 2-[4-[(Z)-4-chlorobut-2-enoxy]-3-hydroxyphenyl]-5-(4-hydroxyphenyl)-3,6-dimethoxyphenol.
| Compound Name | 2-[4-[(Z)-4-chlorobut-2-enoxy]-3-hydroxyphenyl]-5-(4-hydroxyphenyl)-3,6-dimethoxyphenol |
|---|---|
| PubChem CID | 58666110 |
| Molecular Formula | C24H23ClO6 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 2-[4-[(Z)-4-chlorobut-2-enoxy]-3-hydroxyphenyl]-5-(4-hydroxyphenyl)-3,6-dimethoxyphenol |
| SMILES | COc1cc(-c2ccc(O)cc2)c(OC)c(O)c1-c1ccc(OC/C=C\CCl)c(O)c1 |
| InChI | InChI=1S/C24H23ClO6/c1-29-21-14-18(15-5-8-17(26)9-6-15)24(30-2)23(28)22(21)16-7-10-20(19(27)13-16)31-12-4-3-11-25/h3-10,13-14,26-28H,11-12H2,1-2H3/b4-3- |
| InChIKey | QDTICIGODUJJKF-ARJAWSKDSA-N |
| XLogP | 5.33 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|