C25H21ClO6 — CID 23538538
2-[4-(4-chloropent-4-en-2-ynoxy)-3-hydroxyphenyl]-5-(4-hydroxyphenyl)-3,6-dimethoxyphenol (PubChem CID 23538538) has the molecular formula C25H21ClO6 and a molecular weight of 452.89 g/mol. Its IUPAC name is 2-[4-(4-chloropent-4-en-2-ynoxy)-3-hydroxyphenyl]-5-(4-hydroxyphenyl)-3,6-dimethoxyphenol.
| Compound Name | 2-[4-(4-chloropent-4-en-2-ynoxy)-3-hydroxyphenyl]-5-(4-hydroxyphenyl)-3,6-dimethoxyphenol |
|---|---|
| PubChem CID | 23538538 |
| Molecular Formula | C25H21ClO6 |
| Molecular Weight | 452.89 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 2-[4-(4-chloropent-4-en-2-ynoxy)-3-hydroxyphenyl]-5-(4-hydroxyphenyl)-3,6-dimethoxyphenol |
| SMILES | C=C(Cl)C#CCOc1ccc(-c2c(OC)cc(-c3ccc(O)cc3)c(OC)c2O)cc1O |
| InChI | InChI=1S/C25H21ClO6/c1-15(26)5-4-12-32-21-11-8-17(13-20(21)28)23-22(30-2)14-19(25(31-3)24(23)29)16-6-9-18(27)10-7-16/h6-11,13-14,27-29H,1,12H2,2-3H3 |
| InChIKey | JKHBKJPCUHTKBG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.89 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|