C28H23NO6 — CID 23539233
5-(4-hydroxyphenyl)-2-[3-hydroxy-4-(3-pyridin-2-ylprop-2-ynoxy)phenyl]-3,6-dimethoxyphenol (PubChem CID 23539233) has the molecular formula C28H23NO6 and a molecular weight of 469.49 g/mol. Its IUPAC name is 5-(4-hydroxyphenyl)-2-[3-hydroxy-4-(3-pyridin-2-ylprop-2-ynoxy)phenyl]-3,6-dimethoxyphenol.
| Compound Name | 5-(4-hydroxyphenyl)-2-[3-hydroxy-4-(3-pyridin-2-ylprop-2-ynoxy)phenyl]-3,6-dimethoxyphenol |
|---|---|
| PubChem CID | 23539233 |
| Molecular Formula | C28H23NO6 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 5-(4-hydroxyphenyl)-2-[3-hydroxy-4-(3-pyridin-2-ylprop-2-ynoxy)phenyl]-3,6-dimethoxyphenol |
| SMILES | COc1cc(-c2ccc(O)cc2)c(OC)c(O)c1-c1ccc(OCC#Cc2ccccn2)c(O)c1 |
| InChI | InChI=1S/C28H23NO6/c1-33-25-17-22(18-8-11-21(30)12-9-18)28(34-2)27(32)26(25)19-10-13-24(23(31)16-19)35-15-5-7-20-6-3-4-14-29-20/h3-4,6,8-14,16-17,30-32H,15H2,1-2H3 |
| InChIKey | BLFBRDJBIBSCPR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|