C24H20O6 — CID 23538665
2-(4-but-3-en-1-ynoxy-3-hydroxyphenyl)-5-(4-hydroxyphenyl)-3,6-dimethoxyphenol (PubChem CID 23538665) has the molecular formula C24H20O6 and a molecular weight of 404.42 g/mol. Its IUPAC name is 2-(4-but-3-en-1-ynoxy-3-hydroxyphenyl)-5-(4-hydroxyphenyl)-3,6-dimethoxyphenol.
| Compound Name | 2-(4-but-3-en-1-ynoxy-3-hydroxyphenyl)-5-(4-hydroxyphenyl)-3,6-dimethoxyphenol |
|---|---|
| PubChem CID | 23538665 |
| Molecular Formula | C24H20O6 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-(4-but-3-en-1-ynoxy-3-hydroxyphenyl)-5-(4-hydroxyphenyl)-3,6-dimethoxyphenol |
| SMILES | C=CC#COc1ccc(-c2c(OC)cc(-c3ccc(O)cc3)c(OC)c2O)cc1O |
| InChI | InChI=1S/C24H20O6/c1-4-5-12-30-20-11-8-16(13-19(20)26)22-21(28-2)14-18(24(29-3)23(22)27)15-6-9-17(25)10-7-15/h4,6-11,13-14,25-27H,1H2,2-3H3 |
| InChIKey | AVZVEZGUFSEXMI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|