C21H25NO — CID 59031498
(E)-3-(2,5-dimethyl-4-phenylphenyl)-2-methyl-N-propan-2-ylprop-2-enamide (PubChem CID 59031498) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is (E)-3-(2,5-dimethyl-4-phenylphenyl)-2-methyl-N-propan-2-ylprop-2-enamide.
| Compound Name | (E)-3-(2,5-dimethyl-4-phenylphenyl)-2-methyl-N-propan-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 59031498 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (E)-3-(2,5-dimethyl-4-phenylphenyl)-2-methyl-N-propan-2-ylprop-2-enamide |
| SMILES | C/C(=C\c1cc(C)c(-c2ccccc2)cc1C)C(=O)NC(C)C |
| InChI | InChI=1S/C21H25NO/c1-14(2)22-21(23)17(5)12-19-11-16(4)20(13-15(19)3)18-9-7-6-8-10-18/h6-14H,1-5H3,(H,22,23)/b17-12+ |
| InChIKey | WECNNZOPLRIFIY-SFQUDFHCSA-N |
| XLogP | 4.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|