C27H29FN2O3S — CID 59031309
(E)-N-(benzenesulfonyl)-3-[4-[3-fluoro-4-(propan-2-ylamino)phenyl]-2,5-dimethylphenyl]-2-methylprop-2-enamide (PubChem CID 59031309) has the molecular formula C27H29FN2O3S and a molecular weight of 480.61 g/mol. Its IUPAC name is (E)-N-(benzenesulfonyl)-3-[4-[3-fluoro-4-(propan-2-ylamino)phenyl]-2,5-dimethylphenyl]-2-methylprop-2-enamide.
| Compound Name | (E)-N-(benzenesulfonyl)-3-[4-[3-fluoro-4-(propan-2-ylamino)phenyl]-2,5-dimethylphenyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 59031309 |
| Molecular Formula | C27H29FN2O3S |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | (E)-N-(benzenesulfonyl)-3-[4-[3-fluoro-4-(propan-2-ylamino)phenyl]-2,5-dimethylphenyl]-2-methylprop-2-enamide |
| SMILES | C/C(=C\c1cc(C)c(-c2ccc(NC(C)C)c(F)c2)cc1C)C(=O)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H29FN2O3S/c1-17(2)29-26-12-11-21(16-25(26)28)24-15-18(3)22(13-19(24)4)14-20(5)27(31)30-34(32,33)23-9-7-6-8-10-23/h6-17,29H,1-5H3,(H,30,31)/b20-14+ |
| InChIKey | KDXDQEMGXNOUQD-XSFVSMFZSA-N |
| XLogP | 5.84 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|