C26H34N2O2 — CID 91018713
3-[4-[4-(cyclopentylamino)phenyl]-2,5-dimethylphenyl]-N-[(2S)-1-hydroxypropan-2-yl]-2-methylprop-2-enamide (PubChem CID 91018713) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is 3-[4-[4-(cyclopentylamino)phenyl]-2,5-dimethylphenyl]-N-[(2S)-1-hydroxypropan-2-yl]-2-methylprop-2-enamide.
| Compound Name | 3-[4-[4-(cyclopentylamino)phenyl]-2,5-dimethylphenyl]-N-[(2S)-1-hydroxypropan-2-yl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 91018713 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 3-[4-[4-(cyclopentylamino)phenyl]-2,5-dimethylphenyl]-N-[(2S)-1-hydroxypropan-2-yl]-2-methylprop-2-enamide |
| SMILES | CC(=Cc1cc(C)c(-c2ccc(NC3CCCC3)cc2)cc1C)C(=O)N[C@@H](C)CO |
| InChI | InChI=1S/C26H34N2O2/c1-17-15-25(21-9-11-24(12-10-21)28-23-7-5-6-8-23)18(2)13-22(17)14-19(3)26(30)27-20(4)16-29/h9-15,20,23,28-29H,5-8,16H2,1-4H3,(H,27,30)/t20-/m0/s1 |
| InChIKey | OZQUTVXLFAMNDT-FQEVSTJZSA-N |
| XLogP | 5.23 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|