C23H24N2O3 — CID 59031669
3-[[(E)-3-[4-(1H-indol-5-yl)-2,5-dimethylphenyl]-2-methylprop-2-enoyl]amino]propanoic acid (PubChem CID 59031669) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 3-[[(E)-3-[4-(1H-indol-5-yl)-2,5-dimethylphenyl]-2-methylprop-2-enoyl]amino]propanoic acid.
| Compound Name | 3-[[(E)-3-[4-(1H-indol-5-yl)-2,5-dimethylphenyl]-2-methylprop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 59031669 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 3-[[(E)-3-[4-(1H-indol-5-yl)-2,5-dimethylphenyl]-2-methylprop-2-enoyl]amino]propanoic acid |
| SMILES | C/C(=C\c1cc(C)c(-c2ccc3[nH]ccc3c2)cc1C)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C23H24N2O3/c1-14-12-20(17-4-5-21-18(13-17)6-8-24-21)15(2)10-19(14)11-16(3)23(28)25-9-7-22(26)27/h4-6,8,10-13,24H,7,9H2,1-3H3,(H,25,28)(H,26,27)/b16-11+ |
| InChIKey | HRENPUHDQIKXCI-LFIBNONCSA-N |
| XLogP | 4.45 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|