C19H18N2O2 — CID 59031318
(E)-3-[4-(3H-benzimidazol-5-yl)-2,5-dimethylphenyl]-2-methylprop-2-enoic acid (PubChem CID 59031318) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is (E)-3-[4-(3H-benzimidazol-5-yl)-2,5-dimethylphenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[4-(3H-benzimidazol-5-yl)-2,5-dimethylphenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 59031318 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | (E)-3-[4-(3H-benzimidazol-5-yl)-2,5-dimethylphenyl]-2-methylprop-2-enoic acid |
| SMILES | C/C(=C\c1cc(C)c(-c2ccc3nc[nH]c3c2)cc1C)C(=O)O |
| InChI | InChI=1S/C19H18N2O2/c1-11-8-16(12(2)6-15(11)7-13(3)19(22)23)14-4-5-17-18(9-14)21-10-20-17/h4-10H,1-3H3,(H,20,21)(H,22,23)/b13-7+ |
| InChIKey | FQTIFSBEUFEVOU-NTUHNPAUSA-N |
| XLogP | 4.33 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|