C16H13FN2O3 — CID 171064427
3-(3H-benzimidazol-5-yl)-5-fluoro-4-(1-hydroxyethyl)benzoic acid (PubChem CID 171064427) has the molecular formula C16H13FN2O3 and a molecular weight of 300.29 g/mol. Its IUPAC name is 3-(3H-benzimidazol-5-yl)-5-fluoro-4-(1-hydroxyethyl)benzoic acid.
| Compound Name | 3-(3H-benzimidazol-5-yl)-5-fluoro-4-(1-hydroxyethyl)benzoic acid |
|---|---|
| PubChem CID | 171064427 |
| Molecular Formula | C16H13FN2O3 |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 3-(3H-benzimidazol-5-yl)-5-fluoro-4-(1-hydroxyethyl)benzoic acid |
| SMILES | CC(O)c1c(F)cc(C(=O)O)cc1-c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C16H13FN2O3/c1-8(20)15-11(4-10(16(21)22)5-12(15)17)9-2-3-13-14(6-9)19-7-18-13/h2-8,20H,1H3,(H,18,19)(H,21,22) |
| InChIKey | OOHGPFMVTMLJIQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |