C24H26N2O — CID 59031329
(E)-N-cyclopentyl-3-[4-(1H-indol-5-yl)-2,5-dimethylphenyl]prop-2-enamide (PubChem CID 59031329) has the molecular formula C24H26N2O and a molecular weight of 358.49 g/mol. Its IUPAC name is (E)-N-cyclopentyl-3-[4-(1H-indol-5-yl)-2,5-dimethylphenyl]prop-2-enamide.
| Compound Name | (E)-N-cyclopentyl-3-[4-(1H-indol-5-yl)-2,5-dimethylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 59031329 |
| Molecular Formula | C24H26N2O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (E)-N-cyclopentyl-3-[4-(1H-indol-5-yl)-2,5-dimethylphenyl]prop-2-enamide |
| SMILES | Cc1cc(-c2ccc3[nH]ccc3c2)c(C)cc1/C=C/C(=O)NC1CCCC1 |
| InChI | InChI=1S/C24H26N2O/c1-16-14-22(19-7-9-23-20(15-19)11-12-25-23)17(2)13-18(16)8-10-24(27)26-21-5-3-4-6-21/h7-15,21,25H,3-6H2,1-2H3,(H,26,27)/b10-8+ |
| InChIKey | UTMYVLGKUKZOLW-CSKARUKUSA-N |
| XLogP | 5.52 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|