C28H38N2O — CID 59031500
(E)-N-cyclopentyl-2-methyl-3-[2,3,5,6-tetramethyl-4-[4-(propan-2-ylamino)phenyl]phenyl]prop-2-enamide (PubChem CID 59031500) has the molecular formula C28H38N2O and a molecular weight of 418.63 g/mol. Its IUPAC name is (E)-N-cyclopentyl-2-methyl-3-[2,3,5,6-tetramethyl-4-[4-(propan-2-ylamino)phenyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-cyclopentyl-2-methyl-3-[2,3,5,6-tetramethyl-4-[4-(propan-2-ylamino)phenyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 59031500 |
| Molecular Formula | C28H38N2O |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.30 |
| IUPAC Name | (E)-N-cyclopentyl-2-methyl-3-[2,3,5,6-tetramethyl-4-[4-(propan-2-ylamino)phenyl]phenyl]prop-2-enamide |
| SMILES | C/C(=C\c1c(C)c(C)c(-c2ccc(NC(C)C)cc2)c(C)c1C)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C28H38N2O/c1-17(2)29-25-14-12-23(13-15-25)27-21(6)19(4)26(20(5)22(27)7)16-18(3)28(31)30-24-10-8-9-11-24/h12-17,24,29H,8-11H2,1-7H3,(H,30,31)/b18-16+ |
| InChIKey | NWZOQTFBXKUCNO-FBMGVBCBSA-N |
| XLogP | 6.87 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|