C22H25NO2 — CID 59031301
3-[2,3,5,6-tetramethyl-4-[4-(propan-2-ylamino)phenyl]phenyl]prop-2-ynoic acid (PubChem CID 59031301) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 3-[2,3,5,6-tetramethyl-4-[4-(propan-2-ylamino)phenyl]phenyl]prop-2-ynoic acid.
| Compound Name | 3-[2,3,5,6-tetramethyl-4-[4-(propan-2-ylamino)phenyl]phenyl]prop-2-ynoic acid |
|---|---|
| PubChem CID | 59031301 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 3-[2,3,5,6-tetramethyl-4-[4-(propan-2-ylamino)phenyl]phenyl]prop-2-ynoic acid |
| SMILES | Cc1c(C)c(-c2ccc(NC(C)C)cc2)c(C)c(C)c1C#CC(=O)O |
| InChI | InChI=1S/C22H25NO2/c1-13(2)23-19-9-7-18(8-10-19)22-16(5)14(3)20(11-12-21(24)25)15(4)17(22)6/h7-10,13,23H,1-6H3,(H,24,25) |
| InChIKey | VAMMNKFEJQQHKA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|