C31H42N2O3 — CID 59031195
(2E)-N-cyclopentyl-2-[[4-[4-(cyclopentylamino)phenyl]-2,5-dimethoxy-3,6-dimethylphenyl]methylidene]butanamide (PubChem CID 59031195) has the molecular formula C31H42N2O3 and a molecular weight of 490.69 g/mol. Its IUPAC name is (2E)-N-cyclopentyl-2-[[4-[4-(cyclopentylamino)phenyl]-2,5-dimethoxy-3,6-dimethylphenyl]methylidene]butanamide.
| Compound Name | (2E)-N-cyclopentyl-2-[[4-[4-(cyclopentylamino)phenyl]-2,5-dimethoxy-3,6-dimethylphenyl]methylidene]butanamide |
|---|---|
| PubChem CID | 59031195 |
| Molecular Formula | C31H42N2O3 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.32 |
| IUPAC Name | (2E)-N-cyclopentyl-2-[[4-[4-(cyclopentylamino)phenyl]-2,5-dimethoxy-3,6-dimethylphenyl]methylidene]butanamide |
| SMILES | CC/C(=C\c1c(C)c(OC)c(-c2ccc(NC3CCCC3)cc2)c(C)c1OC)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C31H42N2O3/c1-6-22(31(34)33-25-13-9-10-14-25)19-27-20(2)30(36-5)28(21(3)29(27)35-4)23-15-17-26(18-16-23)32-24-11-7-8-12-24/h15-19,24-25,32H,6-14H2,1-5H3,(H,33,34)/b22-19+ |
| InChIKey | UWDPUGXJYFPMDP-ZBJSNUHESA-N |
| XLogP | 7.19 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|