C24H27F2NO2 — CID 59031333
(2E)-2-[[4-[4-(cyclopentylamino)phenyl]-2,5-difluoro-3,6-dimethylphenyl]methylidene]butanoic acid (PubChem CID 59031333) has the molecular formula C24H27F2NO2 and a molecular weight of 399.48 g/mol. Its IUPAC name is (2E)-2-[[4-[4-(cyclopentylamino)phenyl]-2,5-difluoro-3,6-dimethylphenyl]methylidene]butanoic acid.
| Compound Name | (2E)-2-[[4-[4-(cyclopentylamino)phenyl]-2,5-difluoro-3,6-dimethylphenyl]methylidene]butanoic acid |
|---|---|
| PubChem CID | 59031333 |
| Molecular Formula | C24H27F2NO2 |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | (2E)-2-[[4-[4-(cyclopentylamino)phenyl]-2,5-difluoro-3,6-dimethylphenyl]methylidene]butanoic acid |
| SMILES | CC/C(=C\c1c(C)c(F)c(-c2ccc(NC3CCCC3)cc2)c(C)c1F)C(=O)O |
| InChI | InChI=1S/C24H27F2NO2/c1-4-16(24(28)29)13-20-14(2)23(26)21(15(3)22(20)25)17-9-11-19(12-10-17)27-18-7-5-6-8-18/h9-13,18,27H,4-8H2,1-3H3,(H,28,29)/b16-13+ |
| InChIKey | BETHADASLJSRMG-DTQAZKPQSA-N |
| XLogP | 6.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|