C25H27NO5 — CID 59031392
(E)-3-[4-[4-(furan-2-ylmethylamino)phenyl]-2,5-dimethoxy-3,6-dimethylphenyl]-2-methylprop-2-enoic acid (PubChem CID 59031392) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is (E)-3-[4-[4-(furan-2-ylmethylamino)phenyl]-2,5-dimethoxy-3,6-dimethylphenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[4-[4-(furan-2-ylmethylamino)phenyl]-2,5-dimethoxy-3,6-dimethylphenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 59031392 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | (E)-3-[4-[4-(furan-2-ylmethylamino)phenyl]-2,5-dimethoxy-3,6-dimethylphenyl]-2-methylprop-2-enoic acid |
| SMILES | COc1c(C)c(-c2ccc(NCc3ccco3)cc2)c(OC)c(C)c1/C=C(\C)C(=O)O |
| InChI | InChI=1S/C25H27NO5/c1-15(25(27)28)13-21-16(2)24(30-5)22(17(3)23(21)29-4)18-8-10-19(11-9-18)26-14-20-7-6-12-31-20/h6-13,26H,14H2,1-5H3,(H,27,28)/b15-13+ |
| InChIKey | PEGKSIIELBHWLB-FYWRMAATSA-N |
| XLogP | 5.68 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|