C27H35N3O — CID 59031549
(E)-3-[4-[6-(cyclopentylamino)-3-pyridinyl]-2,3,5,6-tetramethylphenyl]-N-cyclopropyl-2-methylprop-2-enamide (PubChem CID 59031549) has the molecular formula C27H35N3O and a molecular weight of 417.60 g/mol. Its IUPAC name is (E)-3-[4-[6-(cyclopentylamino)-3-pyridinyl]-2,3,5,6-tetramethylphenyl]-N-cyclopropyl-2-methylprop-2-enamide.
| Compound Name | (E)-3-[4-[6-(cyclopentylamino)-3-pyridinyl]-2,3,5,6-tetramethylphenyl]-N-cyclopropyl-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 59031549 |
| Molecular Formula | C27H35N3O |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.28 |
| IUPAC Name | (E)-3-[4-[6-(cyclopentylamino)-3-pyridinyl]-2,3,5,6-tetramethylphenyl]-N-cyclopropyl-2-methylprop-2-enamide |
| SMILES | C/C(=C\c1c(C)c(C)c(-c2ccc(NC3CCCC3)nc2)c(C)c1C)C(=O)NC1CC1 |
| InChI | InChI=1S/C27H35N3O/c1-16(27(31)30-23-11-12-23)14-24-17(2)19(4)26(20(5)18(24)3)21-10-13-25(28-15-21)29-22-8-6-7-9-22/h10,13-15,22-23H,6-9,11-12H2,1-5H3,(H,28,29)(H,30,31)/b16-14+ |
| InChIKey | RSVVEJGCBGRLRX-JQIJEIRASA-N |
| XLogP | 6.02 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|