C11H15N3O — CID 112722808
6-(cyclopentylamino)pyridine-3-carboxamide (PubChem CID 112722808) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 6-(cyclopentylamino)pyridine-3-carboxamide.
| Compound Name | 6-(cyclopentylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 112722808 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 6-(cyclopentylamino)pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(NC2CCCC2)nc1 |
| InChI | InChI=1S/C11H15N3O/c12-11(15)8-5-6-10(13-7-8)14-9-3-1-2-4-9/h5-7,9H,1-4H2,(H2,12,15)(H,13,14) |
| InChIKey | HTKJVDABQHUEPR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |