C20H21F2NO2 — CID 59031612
(E)-2-fluoro-3-[4-[2-fluoro-4-(propan-2-ylamino)phenyl]-2,5-dimethylphenyl]prop-2-enoic acid (PubChem CID 59031612) has the molecular formula C20H21F2NO2 and a molecular weight of 345.39 g/mol. Its IUPAC name is (E)-2-fluoro-3-[4-[2-fluoro-4-(propan-2-ylamino)phenyl]-2,5-dimethylphenyl]prop-2-enoic acid.
| Compound Name | (E)-2-fluoro-3-[4-[2-fluoro-4-(propan-2-ylamino)phenyl]-2,5-dimethylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 59031612 |
| Molecular Formula | C20H21F2NO2 |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | (E)-2-fluoro-3-[4-[2-fluoro-4-(propan-2-ylamino)phenyl]-2,5-dimethylphenyl]prop-2-enoic acid |
| SMILES | Cc1cc(-c2ccc(NC(C)C)cc2F)c(C)cc1/C=C(/F)C(=O)O |
| InChI | InChI=1S/C20H21F2NO2/c1-11(2)23-15-5-6-16(18(21)10-15)17-8-12(3)14(7-13(17)4)9-19(22)20(24)25/h5-11,23H,1-4H3,(H,24,25)/b19-9+ |
| InChIKey | STAUWJNCOXNWLO-DJKKODMXSA-N |
| XLogP | 5.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|