C23H27FN2O3 — CID 91472211
(2R)-2-[[3-[2,5-dimethyl-4-[4-(propan-2-ylamino)phenyl]phenyl]-2-fluoroprop-2-enoyl]amino]propanoic acid (PubChem CID 91472211) has the molecular formula C23H27FN2O3 and a molecular weight of 398.48 g/mol. Its IUPAC name is (2R)-2-[[3-[2,5-dimethyl-4-[4-(propan-2-ylamino)phenyl]phenyl]-2-fluoroprop-2-enoyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[3-[2,5-dimethyl-4-[4-(propan-2-ylamino)phenyl]phenyl]-2-fluoroprop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 91472211 |
| Molecular Formula | C23H27FN2O3 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | (2R)-2-[[3-[2,5-dimethyl-4-[4-(propan-2-ylamino)phenyl]phenyl]-2-fluoroprop-2-enoyl]amino]propanoic acid |
| SMILES | Cc1cc(-c2ccc(NC(C)C)cc2)c(C)cc1C=C(F)C(=O)N[C@H](C)C(=O)O |
| InChI | InChI=1S/C23H27FN2O3/c1-13(2)25-19-8-6-17(7-9-19)20-11-14(3)18(10-15(20)4)12-21(24)22(27)26-16(5)23(28)29/h6-13,16,25H,1-5H3,(H,26,27)(H,28,29)/t16-/m1/s1 |
| InChIKey | KPFHRKBKPBNIHC-MRXNPFEDSA-N |
| XLogP | 4.69 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|