C22H23FN2O3 — CID 71154757
(2R)-2-[[(E)-3-[4-(2,3-dihydro-1H-indol-5-yl)-2,5-dimethylphenyl]-2-fluoroprop-2-enoyl]amino]propanoic acid (PubChem CID 71154757) has the molecular formula C22H23FN2O3 and a molecular weight of 382.44 g/mol. Its IUPAC name is (2R)-2-[[(E)-3-[4-(2,3-dihydro-1H-indol-5-yl)-2,5-dimethylphenyl]-2-fluoroprop-2-enoyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[(E)-3-[4-(2,3-dihydro-1H-indol-5-yl)-2,5-dimethylphenyl]-2-fluoroprop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 71154757 |
| Molecular Formula | C22H23FN2O3 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | (2R)-2-[[(E)-3-[4-(2,3-dihydro-1H-indol-5-yl)-2,5-dimethylphenyl]-2-fluoroprop-2-enoyl]amino]propanoic acid |
| SMILES | Cc1cc(-c2ccc3c(c2)CCN3)c(C)cc1/C=C(/F)C(=O)N[C@H](C)C(=O)O |
| InChI | InChI=1S/C22H23FN2O3/c1-12-9-18(15-4-5-20-16(10-15)6-7-24-20)13(2)8-17(12)11-19(23)21(26)25-14(3)22(27)28/h4-5,8-11,14,24H,6-7H2,1-3H3,(H,25,26)(H,27,28)/b19-11+/t14-/m1/s1 |
| InChIKey | NCFGYDJRPOTMMB-HIPSJFSSSA-N |
| XLogP | 3.84 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|