C16H16FN — CID 106878936
5-(4-fluoro-2,6-dimethylphenyl)-2,3-dihydro-1H-indole (PubChem CID 106878936) has the molecular formula C16H16FN and a molecular weight of 241.31 g/mol. Its IUPAC name is 5-(4-fluoro-2,6-dimethylphenyl)-2,3-dihydro-1H-indole.
| Compound Name | 5-(4-fluoro-2,6-dimethylphenyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 106878936 |
| Molecular Formula | C16H16FN |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 5-(4-fluoro-2,6-dimethylphenyl)-2,3-dihydro-1H-indole |
| SMILES | Cc1cc(F)cc(C)c1-c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C16H16FN/c1-10-7-14(17)8-11(2)16(10)13-3-4-15-12(9-13)5-6-18-15/h3-4,7-9,18H,5-6H2,1-2H3 |
| InChIKey | QHZJHGYKVLQZDQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |