C15H11F4N — CID 107289622
5-[4-fluoro-3-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indole (PubChem CID 107289622) has the molecular formula C15H11F4N and a molecular weight of 281.25 g/mol. Its IUPAC name is 5-[4-fluoro-3-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indole.
| Compound Name | 5-[4-fluoro-3-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 107289622 |
| Molecular Formula | C15H11F4N |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 5-[4-fluoro-3-(trifluoromethyl)phenyl]-2,3-dihydro-1H-indole |
| SMILES | Fc1ccc(-c2ccc3c(c2)CCN3)cc1C(F)(F)F |
| InChI | InChI=1S/C15H11F4N/c16-13-3-1-10(8-12(13)15(17,18)19)9-2-4-14-11(7-9)5-6-20-14/h1-4,7-8,20H,5-6H2 |
| InChIKey | XDZCHJFVQMBKHA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |