C19H23N — CID 63424136
5-(2,3,4,5,6-pentamethylphenyl)-2,3-dihydro-1H-indole (PubChem CID 63424136) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is 5-(2,3,4,5,6-pentamethylphenyl)-2,3-dihydro-1H-indole.
| Compound Name | 5-(2,3,4,5,6-pentamethylphenyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 63424136 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 5-(2,3,4,5,6-pentamethylphenyl)-2,3-dihydro-1H-indole |
| SMILES | Cc1c(C)c(C)c(-c2ccc3c(c2)CCN3)c(C)c1C |
| InChI | InChI=1S/C19H23N/c1-11-12(2)14(4)19(15(5)13(11)3)17-6-7-18-16(10-17)8-9-20-18/h6-7,10,20H,8-9H2,1-5H3 |
| InChIKey | NSMQTISOFJFKKU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |