About 3-(2,3-dihydro-1H-indol-5-yl)-4-methyl-5,6-dihydro-1-benzazocine
3-(2,3-dihydro-1H-indol-5-yl)-4-methyl-5,6-dihydro-1-benzazocine (PubChem CID 91561975) has the molecular formula C20H20N2
and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-indol-5-yl)-4-methyl-5,6-dihydro-1-benzazocine.
Molecular Properties
| Compound Name | 3-(2,3-dihydro-1H-indol-5-yl)-4-methyl-5,6-dihydro-1-benzazocine |
| PubChem CID | 91561975 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 3-(2,3-dihydro-1H-indol-5-yl)-4-methyl-5,6-dihydro-1-benzazocine |
| SMILES | CC1=C(c2ccc3c(c2)CCN3)/C=N\c2ccccc2CC1 |
| InChI | InChI=1S/C20H20N2/c1-14-6-7-15-4-2-3-5-19(15)22-13-18(14)16-8-9-20-17(12-16)10-11-21-20/h2-5,8-9,12-13,21H,6-7,10-11H2,1H3/b18-14?,22-13- |
| InChIKey | CEAHFDBFJWUAIM-YQZXVLLQSA-N |
| XLogP | 4.78 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2,3-dihydro-1H-indol-5-yl)-4-methyl-5,6-dihydro-1-benzazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dihydro-1H-indol-5-yl)-4-methyl-5,6-dihydro-1-benzazocine?
The IUPAC name of 3-(2,3-dihydro-1H-indol-5-yl)-4-methyl-5,6-dihydro-1-benzazocine (CID 91561975) is 3-(2,3-dihydro-1H-indol-5-yl)-4-methyl-5,6-dihydro-1-benzazocine.
What is the SMILES notation for 3-(2,3-dihydro-1H-indol-5-yl)-4-methyl-5,6-dihydro-1-benzazocine?
The canonical SMILES for 3-(2,3-dihydro-1H-indol-5-yl)-4-methyl-5,6-dihydro-1-benzazocine is CC1=C(c2ccc3c(c2)CCN3)/C=N\c2ccccc2CC1.
What is the InChIKey of 3-(2,3-dihydro-1H-indol-5-yl)-4-methyl-5,6-dihydro-1-benzazocine?
The InChIKey is CEAHFDBFJWUAIM-YQZXVLLQSA-N. The full InChI is InChI=1S/C20H20N2/c1-14-6-7-15-4-2-3-5-19(15)22-13-18(14)16-8-9-20-17(12-16)10-11-21-20/h2-5,8-9,12-13,21H,6-7,10-11H2,1H3/b18-14?,22-13-.
What are the key properties of 3-(2,3-dihydro-1H-indol-5-yl)-4-methyl-5,6-dihydro-1-benzazocine?
3-(2,3-dihydro-1H-indol-5-yl)-4-methyl-5,6-dihydro-1-benzazocine has a molecular weight of 288.39 g/mol, XLogP of 4.78, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydro-1H-indol-5-yl)-4-methyl-5,6-dihydro-1-benzazocine is sourced from PubChem (CID 91561975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).