C15H16N2 — CID 116998160
3-(2,3-dihydro-1H-indol-5-yl)-N-methylaniline (PubChem CID 116998160) has the molecular formula C15H16N2 and a molecular weight of 224.31 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-indol-5-yl)-N-methylaniline.
| Compound Name | 3-(2,3-dihydro-1H-indol-5-yl)-N-methylaniline |
|---|---|
| PubChem CID | 116998160 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 3-(2,3-dihydro-1H-indol-5-yl)-N-methylaniline |
| SMILES | CNc1cccc(-c2ccc3c(c2)CCN3)c1 |
| InChI | InChI=1S/C15H16N2/c1-16-14-4-2-3-11(10-14)12-5-6-15-13(9-12)7-8-17-15/h2-6,9-10,16-17H,7-8H2,1H3 |
| InChIKey | PBEUSDWPYFWGOP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |