C14H17N3 — CID 174844526
2,3-dihydro-1H-indole;N-methylpyridin-3-amine (PubChem CID 174844526) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is 2,3-dihydro-1H-indole;N-methylpyridin-3-amine.
| Compound Name | 2,3-dihydro-1H-indole;N-methylpyridin-3-amine |
|---|---|
| PubChem CID | 174844526 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 2,3-dihydro-1H-indole;N-methylpyridin-3-amine |
| SMILES | CNc1cccnc1.c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C8H9N.C6H8N2/c1-2-4-8-7(3-1)5-6-9-8;1-7-6-3-2-4-8-5-6/h1-4,9H,5-6H2;2-5,7H,1H3 |
| InChIKey | UPOOYOBTTIQDRA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |