C13H22N2O — CID 170578965
2,3-dihydro-1H-indole;N-methylformamide;propane (PubChem CID 170578965) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 2,3-dihydro-1H-indole;N-methylformamide;propane.
| Compound Name | 2,3-dihydro-1H-indole;N-methylformamide;propane |
|---|---|
| PubChem CID | 170578965 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 2,3-dihydro-1H-indole;N-methylformamide;propane |
| SMILES | CCC.CNC=O.c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C8H9N.C3H8.C2H5NO/c1-2-4-8-7(3-1)5-6-9-8;1-3-2;1-3-2-4/h1-4,9H,5-6H2;3H2,1-2H3;2H,1H3,(H,3,4) |
| InChIKey | ZWTYLJHBVNLQIT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|