C12H16N2O — CID 134786768
5-ethyl-1,2,3,6-tetrahydro-1,5-benzodiazocin-4-one (PubChem CID 134786768) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 5-ethyl-1,2,3,6-tetrahydro-1,5-benzodiazocin-4-one.
| Compound Name | 5-ethyl-1,2,3,6-tetrahydro-1,5-benzodiazocin-4-one |
|---|---|
| PubChem CID | 134786768 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 5-ethyl-1,2,3,6-tetrahydro-1,5-benzodiazocin-4-one |
| SMILES | CCN1Cc2ccccc2NCCC1=O |
| InChI | InChI=1S/C12H16N2O/c1-2-14-9-10-5-3-4-6-11(10)13-8-7-12(14)15/h3-6,13H,2,7-9H2,1H3 |
| InChIKey | WFJMYKTVJQOYMQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |