C15H23NO — CID 174749146
2,3-dihydro-1H-indole;heptan-4-one (PubChem CID 174749146) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 2,3-dihydro-1H-indole;heptan-4-one.
| Compound Name | 2,3-dihydro-1H-indole;heptan-4-one |
|---|---|
| PubChem CID | 174749146 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 2,3-dihydro-1H-indole;heptan-4-one |
| SMILES | CCCC(=O)CCC.c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C8H9N.C7H14O/c1-2-4-8-7(3-1)5-6-9-8;1-3-5-7(8)6-4-2/h1-4,9H,5-6H2;3-6H2,1-2H3 |
| InChIKey | UCSOISKGICCXGR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |