C14H16N2 — CID 159350025
1H-azepine;2,3-dihydro-1H-indole (PubChem CID 159350025) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 1H-azepine;2,3-dihydro-1H-indole.
| Compound Name | 1H-azepine;2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 159350025 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 1H-azepine;2,3-dihydro-1H-indole |
| SMILES | C1=CC=CNC=C1.c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C8H9N.C6H7N/c1-2-4-8-7(3-1)5-6-9-8;1-2-4-6-7-5-3-1/h1-4,9H,5-6H2;1-7H |
| InChIKey | LHEZUELISXETSY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |