C11H15N3 — CID 159210756
2,3-dihydro-1H-indole;2,3-dihydro-1H-pyrazole (PubChem CID 159210756) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 2,3-dihydro-1H-indole;2,3-dihydro-1H-pyrazole.
| Compound Name | 2,3-dihydro-1H-indole;2,3-dihydro-1H-pyrazole |
|---|---|
| PubChem CID | 159210756 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 2,3-dihydro-1H-indole;2,3-dihydro-1H-pyrazole |
| SMILES | C1=CNNC1.c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C8H9N.C3H6N2/c1-2-4-8-7(3-1)5-6-9-8;1-2-4-5-3-1/h1-4,9H,5-6H2;1-2,4-5H,3H2 |
| InChIKey | KQLSEEZDZYSZNL-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |