C13H14N2 — CID 160958359
2,3-dihydro-1H-indole;pyridine (PubChem CID 160958359) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 2,3-dihydro-1H-indole;pyridine.
| Compound Name | 2,3-dihydro-1H-indole;pyridine |
|---|---|
| PubChem CID | 160958359 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 2,3-dihydro-1H-indole;pyridine |
| SMILES | c1ccc2c(c1)CCN2.c1ccncc1 |
| InChI | InChI=1S/C8H9N.C5H5N/c1-2-4-8-7(3-1)5-6-9-8;1-2-4-6-5-3-1/h1-4,9H,5-6H2;1-5H |
| InChIKey | SWRPRJQESYNMPF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |