C20H21Br3N2O2 — CID 158779578
2-bromoacetyl bromide;2-bromo-1-(2,3-dihydroindol-1-yl)ethanone;2,3-dihydro-1H-indole (PubChem CID 158779578) has the molecular formula C20H21Br3N2O2 and a molecular weight of 561.11 g/mol. Its IUPAC name is 2-bromoacetyl bromide;2-bromo-1-(2,3-dihydroindol-1-yl)ethanone;2,3-dihydro-1H-indole.
| Compound Name | 2-bromoacetyl bromide;2-bromo-1-(2,3-dihydroindol-1-yl)ethanone;2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 158779578 |
| Molecular Formula | C20H21Br3N2O2 |
| Molecular Weight | 561.11 g/mol |
| Exact Mass | 557.92 |
| IUPAC Name | 2-bromoacetyl bromide;2-bromo-1-(2,3-dihydroindol-1-yl)ethanone;2,3-dihydro-1H-indole |
| SMILES | O=C(Br)CBr.O=C(CBr)N1CCc2ccccc21.c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C10H10BrNO.C8H9N.C2H2Br2O/c11-7-10(13)12-6-5-8-3-1-2-4-9(8)12;1-2-4-8-7(3-1)5-6-9-8;3-1-2(4)5/h1-4H,5-7H2;1-4,9H,5-6H2;1H2 |
| InChIKey | IQXAQFONLOBXIT-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.11 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|