C12H18N2O — CID 143510883
N-ethylformamide;5-methyl-2,3-dihydro-1H-indole (PubChem CID 143510883) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is N-ethylformamide;5-methyl-2,3-dihydro-1H-indole.
| Compound Name | N-ethylformamide;5-methyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 143510883 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | N-ethylformamide;5-methyl-2,3-dihydro-1H-indole |
| SMILES | CCNC=O.Cc1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C9H11N.C3H7NO/c1-7-2-3-9-8(6-7)4-5-10-9;1-2-4-3-5/h2-3,6,10H,4-5H2,1H3;3H,2H2,1H3,(H,4,5) |
| InChIKey | NLTHPGYESFJOOF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|