C10H13NO2S — CID 134176519
5-ethylsulfonyl-2,3-dihydro-1H-indole (PubChem CID 134176519) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is 5-ethylsulfonyl-2,3-dihydro-1H-indole.
| Compound Name | 5-ethylsulfonyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 134176519 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 5-ethylsulfonyl-2,3-dihydro-1H-indole |
| SMILES | CCS(=O)(=O)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C10H13NO2S/c1-2-14(12,13)9-3-4-10-8(7-9)5-6-11-10/h3-4,7,11H,2,5-6H2,1H3 |
| InChIKey | YCOOTAUDIBKORK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |