C15H22N2O2S — CID 61443459
N-butyl-N-cyclopropyl-2,3-dihydro-1H-indole-5-sulfonamide (PubChem CID 61443459) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is N-butyl-N-cyclopropyl-2,3-dihydro-1H-indole-5-sulfonamide.
| Compound Name | N-butyl-N-cyclopropyl-2,3-dihydro-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 61443459 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-butyl-N-cyclopropyl-2,3-dihydro-1H-indole-5-sulfonamide |
| SMILES | CCCCN(C1CC1)S(=O)(=O)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C15H22N2O2S/c1-2-3-10-17(13-4-5-13)20(18,19)14-6-7-15-12(11-14)8-9-16-15/h6-7,11,13,16H,2-5,8-10H2,1H3 |
| InChIKey | DSSLMAHRZCHWQA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |