About N-cycloheptyl-N-methyl-2,3-dihydro-1H-indole-5-sulfonamide
N-cycloheptyl-N-methyl-2,3-dihydro-1H-indole-5-sulfonamide (PubChem CID 43614367) has the molecular formula C16H24N2O2S
and a molecular weight of 308.45 g/mol. Its IUPAC name is N-cycloheptyl-N-methyl-2,3-dihydro-1H-indole-5-sulfonamide.
Molecular Properties
| Compound Name | N-cycloheptyl-N-methyl-2,3-dihydro-1H-indole-5-sulfonamide |
| PubChem CID | 43614367 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | N-cycloheptyl-N-methyl-2,3-dihydro-1H-indole-5-sulfonamide |
| SMILES | CN(C1CCCCCC1)S(=O)(=O)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C16H24N2O2S/c1-18(14-6-4-2-3-5-7-14)21(19,20)15-8-9-16-13(12-15)10-11-17-16/h8-9,12,14,17H,2-7,10-11H2,1H3 |
| InChIKey | DNXKXVBASZANSL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cycloheptyl-N-methyl-2,3-dihydro-1H-indole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptyl-N-methyl-2,3-dihydro-1H-indole-5-sulfonamide?
The IUPAC name of N-cycloheptyl-N-methyl-2,3-dihydro-1H-indole-5-sulfonamide (CID 43614367) is N-cycloheptyl-N-methyl-2,3-dihydro-1H-indole-5-sulfonamide.
What is the SMILES notation for N-cycloheptyl-N-methyl-2,3-dihydro-1H-indole-5-sulfonamide?
The canonical SMILES for N-cycloheptyl-N-methyl-2,3-dihydro-1H-indole-5-sulfonamide is CN(C1CCCCCC1)S(=O)(=O)c1ccc2c(c1)CCN2.
What is the InChIKey of N-cycloheptyl-N-methyl-2,3-dihydro-1H-indole-5-sulfonamide?
The InChIKey is DNXKXVBASZANSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O2S/c1-18(14-6-4-2-3-5-7-14)21(19,20)15-8-9-16-13(12-15)10-11-17-16/h8-9,12,14,17H,2-7,10-11H2,1H3.
What are the key properties of N-cycloheptyl-N-methyl-2,3-dihydro-1H-indole-5-sulfonamide?
N-cycloheptyl-N-methyl-2,3-dihydro-1H-indole-5-sulfonamide has a molecular weight of 308.45 g/mol, XLogP of 3.00, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptyl-N-methyl-2,3-dihydro-1H-indole-5-sulfonamide is sourced from PubChem (CID 43614367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).