C10H14N2O2 — CID 19098997
ethanol;5-nitroso-2,3-dihydro-1H-indole (PubChem CID 19098997) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is ethanol;5-nitroso-2,3-dihydro-1H-indole.
| Compound Name | ethanol;5-nitroso-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 19098997 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | ethanol;5-nitroso-2,3-dihydro-1H-indole |
| SMILES | CCO.O=Nc1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C8H8N2O.C2H6O/c11-10-7-1-2-8-6(5-7)3-4-9-8;1-2-3/h1-2,5,9H,3-4H2;3H,2H2,1H3 |
| InChIKey | LOJCBTLZZASJDP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |