C10H13I2N — CID 159662716
6-methyl-1,2,3,4-tetrahydroquinoline;molecular iodine (PubChem CID 159662716) has the molecular formula C10H13I2N and a molecular weight of 401.03 g/mol. Its IUPAC name is 6-methyl-1,2,3,4-tetrahydroquinoline;molecular iodine.
| Compound Name | 6-methyl-1,2,3,4-tetrahydroquinoline;molecular iodine |
|---|---|
| PubChem CID | 159662716 |
| Molecular Formula | C10H13I2N |
| Molecular Weight | 401.03 g/mol |
| Exact Mass | 400.91 |
| IUPAC Name | 6-methyl-1,2,3,4-tetrahydroquinoline;molecular iodine |
| SMILES | Cc1ccc2c(c1)CCCN2.II |
| InChI | InChI=1S/C10H13N.I2/c1-8-4-5-10-9(7-8)3-2-6-11-10;1-2/h4-5,7,11H,2-3,6H2,1H3; |
| InChIKey | MTABZHLEZRCKLA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.03 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|