C21H25N3O — CID 159102364
6-methyl-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one;6-methyl-1,2,3,4-tetrahydroquinoline (PubChem CID 159102364) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is 6-methyl-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one;6-methyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-methyl-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one;6-methyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 159102364 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 6-methyl-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one;6-methyl-1,2,3,4-tetrahydroquinoline |
| SMILES | Cc1cc2c3c(c1)[nH]c(=O)n3CCC2.Cc1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C11H12N2O.C10H13N/c1-7-5-8-3-2-4-13-10(8)9(6-7)12-11(13)14;1-8-4-5-10-9(7-8)3-2-6-11-10/h5-6H,2-4H2,1H3,(H,12,14);4-5,7,11H,2-3,6H2,1H3 |
| InChIKey | KDLHIPLLDURVPX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |