C10H14N2 — CID 16767807
N,N-dimethyl-2,3-dihydro-1H-indol-5-amine (PubChem CID 16767807) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is N,N-dimethyl-2,3-dihydro-1H-indol-5-amine.
| Compound Name | N,N-dimethyl-2,3-dihydro-1H-indol-5-amine |
|---|---|
| PubChem CID | 16767807 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | N,N-dimethyl-2,3-dihydro-1H-indol-5-amine |
| SMILES | CN(C)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C10H14N2/c1-12(2)9-3-4-10-8(7-9)5-6-11-10/h3-4,7,11H,5-6H2,1-2H3 |
| InChIKey | LGAWJAFXFJNWOZ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|